About 4-methylcyclohexan-1-one
4-methylcyclohexan-1-one (PubChem CID 11525) has the molecular formula C7H12O
and a molecular weight of 112.17 g/mol. Its IUPAC name is 4-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | 4-methylcyclohexan-1-one |
| PubChem CID | 11525 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 4-methylcyclohexan-1-one |
| SMILES | CC1CCC(=O)CC1 |
| InChI | InChI=1S/C7H12O/c1-6-2-4-7(8)5-3-6/h6H,2-5H2,1H3 |
| InChIKey | VGVHNLRUAMRIEW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohexan-1-one?
The IUPAC name of 4-methylcyclohexan-1-one (CID 11525) is 4-methylcyclohexan-1-one.
What is the SMILES notation for 4-methylcyclohexan-1-one?
The canonical SMILES for 4-methylcyclohexan-1-one is CC1CCC(=O)CC1.
What is the InChIKey of 4-methylcyclohexan-1-one?
The InChIKey is VGVHNLRUAMRIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O/c1-6-2-4-7(8)5-3-6/h6H,2-5H2,1H3.
What are the key properties of 4-methylcyclohexan-1-one?
4-methylcyclohexan-1-one has a molecular weight of 112.17 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexan-1-one is sourced from PubChem (CID 11525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).