C12H25NO2 — CID 115250399
2-[(3,3-dimethylbutylamino)methyl]-3-methylbutanoic acid (PubChem CID 115250399) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-[(3,3-dimethylbutylamino)methyl]-3-methylbutanoic acid.
| Compound Name | 2-[(3,3-dimethylbutylamino)methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 115250399 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-[(3,3-dimethylbutylamino)methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNCCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-9(2)10(11(14)15)8-13-7-6-12(3,4)5/h9-10,13H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | QOYVMPMIHGRKHO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|