C22H26N4O3S2 — CID 11525404
N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 11525404) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 11525404 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[5-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2-methoxyphenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | COc1ccc(N2C[C@@H](C)N[C@@H](C)C2)cc1NS(=O)(=O)c1ccc(-c2ccccn2)s1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-15-13-26(14-16(2)24-15)17-7-8-20(29-3)19(12-17)25-31(27,28)22-10-9-21(30-22)18-6-4-5-11-23-18/h4-12,15-16,24-25H,13-14H2,1-3H3/t15-,16+ |
| InChIKey | KAPJUSUGIKXBAV-IYBDPMFKSA-N |
| XLogP | 3.81 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|