C14H20N2 — CID 115254066
2-[[2-(2-methylphenyl)ethylamino]methyl]butanenitrile (PubChem CID 115254066) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-[[2-(2-methylphenyl)ethylamino]methyl]butanenitrile.
| Compound Name | 2-[[2-(2-methylphenyl)ethylamino]methyl]butanenitrile |
|---|---|
| PubChem CID | 115254066 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-[[2-(2-methylphenyl)ethylamino]methyl]butanenitrile |
| SMILES | CCC(C#N)CNCCc1ccccc1C |
| InChI | InChI=1S/C14H20N2/c1-3-13(10-15)11-16-9-8-14-7-5-4-6-12(14)2/h4-7,13,16H,3,8-9,11H2,1-2H3 |
| InChIKey | WGZVNGVZWWMKOH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|