C17H26N2 — CID 115254278
2-[(4-tert-butyl-2-methylanilino)methyl]-3-methylbutanenitrile (PubChem CID 115254278) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-[(4-tert-butyl-2-methylanilino)methyl]-3-methylbutanenitrile.
| Compound Name | 2-[(4-tert-butyl-2-methylanilino)methyl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 115254278 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-[(4-tert-butyl-2-methylanilino)methyl]-3-methylbutanenitrile |
| SMILES | Cc1cc(C(C)(C)C)ccc1NCC(C#N)C(C)C |
| InChI | InChI=1S/C17H26N2/c1-12(2)14(10-18)11-19-16-8-7-15(9-13(16)3)17(4,5)6/h7-9,12,14,19H,11H2,1-6H3 |
| InChIKey | LXYBTMMGMYILLM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |