C14H22N2S — CID 115254717
3-methyl-2-[[methyl-[2-(3-methylthiophen-2-yl)ethyl]amino]methyl]butanenitrile (PubChem CID 115254717) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 3-methyl-2-[[methyl-[2-(3-methylthiophen-2-yl)ethyl]amino]methyl]butanenitrile.
| Compound Name | 3-methyl-2-[[methyl-[2-(3-methylthiophen-2-yl)ethyl]amino]methyl]butanenitrile |
|---|---|
| PubChem CID | 115254717 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-methyl-2-[[methyl-[2-(3-methylthiophen-2-yl)ethyl]amino]methyl]butanenitrile |
| SMILES | Cc1ccsc1CCN(C)CC(C#N)C(C)C |
| InChI | InChI=1S/C14H22N2S/c1-11(2)13(9-15)10-16(4)7-5-14-12(3)6-8-17-14/h6,8,11,13H,5,7,10H2,1-4H3 |
| InChIKey | SDALZJGGIONDNS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |