C25H29N5O2S — CID 11525525
8-(furan-2-yl)-4,4-dimethyl-N-(2-morpholin-4-ylethyl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine (PubChem CID 11525525) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 8-(furan-2-yl)-4,4-dimethyl-N-(2-morpholin-4-ylethyl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine.
| Compound Name | 8-(furan-2-yl)-4,4-dimethyl-N-(2-morpholin-4-ylethyl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine |
|---|---|
| PubChem CID | 11525525 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 8-(furan-2-yl)-4,4-dimethyl-N-(2-morpholin-4-ylethyl)-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1,7,9,12,14,16-hexaen-13-amine |
| SMILES | CC1(C)CCc2c(-c3ccco3)nc3sc4c(NCCN5CCOCC5)ncnc4c3c2C1 |
| InChI | InChI=1S/C25H29N5O2S/c1-25(2)6-5-16-17(14-25)19-21-22(33-24(19)29-20(16)18-4-3-11-32-18)23(28-15-27-21)26-7-8-30-9-12-31-13-10-30/h3-4,11,15H,5-10,12-14H2,1-2H3,(H,26,27,28) |
| InChIKey | BNUQRBLZFCEYSG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |