C22H34N3O6P — CID 11525606
[1-[1-[2-[3,3-dimethylbutyl(ethyl)amino]-2-oxoethyl]-6-methoxyindazol-3-yl]-2-methylprop-1-enyl] dihydrogen phosphate (PubChem CID 11525606) has the molecular formula C22H34N3O6P and a molecular weight of 467.50 g/mol. Its IUPAC name is [1-[1-[2-[3,3-dimethylbutyl(ethyl)amino]-2-oxoethyl]-6-methoxyindazol-3-yl]-2-methylprop-1-enyl] dihydrogen phosphate.
| Compound Name | [1-[1-[2-[3,3-dimethylbutyl(ethyl)amino]-2-oxoethyl]-6-methoxyindazol-3-yl]-2-methylprop-1-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11525606 |
| Molecular Formula | C22H34N3O6P |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | [1-[1-[2-[3,3-dimethylbutyl(ethyl)amino]-2-oxoethyl]-6-methoxyindazol-3-yl]-2-methylprop-1-enyl] dihydrogen phosphate |
| SMILES | CCN(CCC(C)(C)C)C(=O)Cn1nc(C(OP(=O)(O)O)=C(C)C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C22H34N3O6P/c1-8-24(12-11-22(4,5)6)19(26)14-25-18-13-16(30-7)9-10-17(18)20(23-25)21(15(2)3)31-32(27,28)29/h9-10,13H,8,11-12,14H2,1-7H3,(H2,27,28,29) |
| InChIKey | DHEZSLXDOQJLEK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|