C20H16ClN7OS2 — CID 11525670
2-[5-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-1,3-benzothiazol-2-yl]guanidine (PubChem CID 11525670) has the molecular formula C20H16ClN7OS2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 2-[5-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-1,3-benzothiazol-2-yl]guanidine.
| Compound Name | 2-[5-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-1,3-benzothiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 11525670 |
| Molecular Formula | C20H16ClN7OS2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 2-[5-[3-(3-chloro-4-cyanophenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-1,3-benzothiazol-2-yl]guanidine |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(Cl)c2)C(=S)N1c1ccc2sc(N=C(N)N)nc2c1 |
| InChI | InChI=1S/C20H16ClN7OS2/c1-20(2)16(29)27(11-4-3-10(9-22)13(21)7-11)19(30)28(20)12-5-6-15-14(8-12)25-18(31-15)26-17(23)24/h3-8H,1-2H3,(H4,23,24,25,26) |
| InChIKey | CIJCIFUYGAZSNJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|