C18H22ClN7O4 — CID 11525704
2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetic acid (PubChem CID 11525704) has the molecular formula C18H22ClN7O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11525704 |
| Molecular Formula | C18H22ClN7O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenoxy]acetic acid |
| SMILES | N/C(=N\CCCCc1ccc(OCC(=O)O)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C18H22ClN7O4/c19-14-16(21)25-15(20)13(24-14)17(29)26-18(22)23-8-2-1-3-10-4-6-11(7-5-10)30-9-12(27)28/h4-7H,1-3,8-9H2,(H,27,28)(H4,20,21,25)(H3,22,23,26,29) |
| InChIKey | GLCZHPOXFBDNLT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 191.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|