C24H25F6NO2 — CID 11525725
N-cyclohexyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpropanamide (PubChem CID 11525725) has the molecular formula C24H25F6NO2 and a molecular weight of 473.46 g/mol. Its IUPAC name is N-cyclohexyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpropanamide.
| Compound Name | N-cyclohexyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 11525725 |
| Molecular Formula | C24H25F6NO2 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-cyclohexyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H25F6NO2/c25-23(26,27)22(33,24(28,29)30)18-12-14-20(15-13-18)31(19-9-5-2-6-10-19)21(32)16-11-17-7-3-1-4-8-17/h1,3-4,7-8,12-15,19,33H,2,5-6,9-11,16H2 |
| InChIKey | UVBRIVHIUGBGEN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |