C25H25F3N2O4 — CID 11525752
3-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]propanoic acid (PubChem CID 11525752) has the molecular formula C25H25F3N2O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is 3-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]propanoic acid.
| Compound Name | 3-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 11525752 |
| Molecular Formula | C25H25F3N2O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 3-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]indol-5-yl]propanoic acid |
| SMILES | CCCc1c(OCCCn2ccc3cc(CCC(=O)O)ccc32)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C25H25F3N2O4/c1-2-4-18-21(9-7-19-23(18)34-29-24(19)25(26,27)28)33-14-3-12-30-13-11-17-15-16(5-8-20(17)30)6-10-22(31)32/h5,7-9,11,13,15H,2-4,6,10,12,14H2,1H3,(H,31,32) |
| InChIKey | AORBCLGGYNFMGN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|