C10H11BrF3NO — CID 115257749
5-bromo-2-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 115257749) has the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 5-bromo-2-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 115257749 |
| Molecular Formula | C10H11BrF3NO |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 5-bromo-2-methoxy-N-methyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COc1ccc(Br)cc1N(C)CC(F)(F)F |
| InChI | InChI=1S/C10H11BrF3NO/c1-15(6-10(12,13)14)8-5-7(11)3-4-9(8)16-2/h3-5H,6H2,1-2H3 |
| InChIKey | ICCNWIIMQDIFTP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |