C26H32F3N3O2 — CID 11525777
[(6R,9aS)-6-(2,3-dimethyl-4-propoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 11525777) has the molecular formula C26H32F3N3O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is [(6R,9aS)-6-(2,3-dimethyl-4-propoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R,9aS)-6-(2,3-dimethyl-4-propoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 11525777 |
| Molecular Formula | C26H32F3N3O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [(6R,9aS)-6-(2,3-dimethyl-4-propoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | CCCOc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c(C)c1C |
| InChI | InChI=1S/C26H32F3N3O2/c1-4-14-34-23-10-9-21(17(2)18(23)3)22-7-5-6-20-16-31(12-13-32(20)22)25(33)19-8-11-24(30-15-19)26(27,28)29/h8-11,15,20,22H,4-7,12-14,16H2,1-3H3/t20-,22+/m0/s1 |
| InChIKey | NVINVVLAMMITSL-RBBKRZOGSA-N |
| XLogP | 5.56 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |