C13H18N2O — CID 115259298
6-[ethyl(methyl)amino]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 115259298) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 6-[ethyl(methyl)amino]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[ethyl(methyl)amino]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 115259298 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 6-[ethyl(methyl)amino]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CCN(C)c1ccc2c(c1)CCC(=O)N2C |
| InChI | InChI=1S/C13H18N2O/c1-4-14(2)11-6-7-12-10(9-11)5-8-13(16)15(12)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | GLLXSVDEGQWNKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|