C15H25N — CID 115259408
N-[(5-tert-butyl-2-methylphenyl)methyl]-N-methylethanamine (PubChem CID 115259408) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-[(5-tert-butyl-2-methylphenyl)methyl]-N-methylethanamine.
| Compound Name | N-[(5-tert-butyl-2-methylphenyl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 115259408 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-[(5-tert-butyl-2-methylphenyl)methyl]-N-methylethanamine |
| SMILES | CCN(C)Cc1cc(C(C)(C)C)ccc1C |
| InChI | InChI=1S/C15H25N/c1-7-16(6)11-13-10-14(15(3,4)5)9-8-12(13)2/h8-10H,7,11H2,1-6H3 |
| InChIKey | LJYOTNLNBYMCJM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |