C18H17N3O2 — CID 11525980
6,7-dimethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine (PubChem CID 11525980) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 6,7-dimethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine.
| Compound Name | 6,7-dimethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
|---|---|
| PubChem CID | 11525980 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 6,7-dimethoxy-N-phenyl-1,4-dihydroindeno[2,1-d]pyrazol-3-amine |
| SMILES | COc1cc2c(cc1OC)-c1[nH]nc(Nc3ccccc3)c1C2 |
| InChI | InChI=1S/C18H17N3O2/c1-22-15-9-11-8-14-17(13(11)10-16(15)23-2)20-21-18(14)19-12-6-4-3-5-7-12/h3-7,9-10H,8H2,1-2H3,(H2,19,20,21) |
| InChIKey | RWKBPANRHRUTJW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |