About N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine
N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine (PubChem CID 115260554) has the molecular formula C6H17N3
and a molecular weight of 131.22 g/mol. Its IUPAC name is N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine |
| PubChem CID | 115260554 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine |
| SMILES | CC(C)CN(C)CNN |
| InChI | InChI=1S/C6H17N3/c1-6(2)4-9(3)5-8-7/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | LVZKZDUAOZEKNJ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine?
The IUPAC name of N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine (CID 115260554) is N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine is CC(C)CN(C)CNN.
What is the InChIKey of N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine?
The InChIKey is LVZKZDUAOZEKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N3/c1-6(2)4-9(3)5-8-7/h6,8H,4-5,7H2,1-3H3.
What are the key properties of N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine?
N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine has a molecular weight of 131.22 g/mol, XLogP of -0.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(hydrazinylmethyl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 115260554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).