C13H22BrN3O — CID 115261045
1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine (PubChem CID 115261045) has the molecular formula C13H22BrN3O and a molecular weight of 316.24 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115261045 |
| Molecular Formula | C13H22BrN3O |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 1-(5-bromo-2-methoxy-3,4,6-trimethylphenyl)-N-(hydrazinylmethyl)-N-methylmethanamine |
| SMILES | COc1c(C)c(C)c(Br)c(C)c1CN(C)CNN |
| InChI | InChI=1S/C13H22BrN3O/c1-8-9(2)13(18-5)11(10(3)12(8)14)6-17(4)7-16-15/h16H,6-7,15H2,1-5H3 |
| InChIKey | CGKKUKOALYGNAH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|