C12H19N3O — CID 115261148
2-(3,4-dihydro-2H-chromen-6-yl)-N-(hydrazinylmethyl)ethanamine (PubChem CID 115261148) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-N-(hydrazinylmethyl)ethanamine.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-N-(hydrazinylmethyl)ethanamine |
|---|---|
| PubChem CID | 115261148 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-N-(hydrazinylmethyl)ethanamine |
| SMILES | NNCNCCc1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C12H19N3O/c13-15-9-14-6-5-10-3-4-12-11(8-10)2-1-7-16-12/h3-4,8,14-15H,1-2,5-7,9,13H2 |
| InChIKey | DYINTHLVDNKLHJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|