C15H27N3 — CID 115261410
N-(hydrazinylmethyl)-2-methyl-2-[4-(2-methylpropyl)phenyl]propan-1-amine (PubChem CID 115261410) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-(hydrazinylmethyl)-2-methyl-2-[4-(2-methylpropyl)phenyl]propan-1-amine.
| Compound Name | N-(hydrazinylmethyl)-2-methyl-2-[4-(2-methylpropyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 115261410 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-(hydrazinylmethyl)-2-methyl-2-[4-(2-methylpropyl)phenyl]propan-1-amine |
| SMILES | CC(C)Cc1ccc(C(C)(C)CNCNN)cc1 |
| InChI | InChI=1S/C15H27N3/c1-12(2)9-13-5-7-14(8-6-13)15(3,4)10-17-11-18-16/h5-8,12,17-18H,9-11,16H2,1-4H3 |
| InChIKey | LWQIRMDHPFJJNY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|