C13H20BrN — CID 115262506
N-(bromomethyl)-2-(2,5-dimethylphenyl)-2-methylpropan-1-amine (PubChem CID 115262506) has the molecular formula C13H20BrN and a molecular weight of 270.21 g/mol. Its IUPAC name is N-(bromomethyl)-2-(2,5-dimethylphenyl)-2-methylpropan-1-amine.
| Compound Name | N-(bromomethyl)-2-(2,5-dimethylphenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115262506 |
| Molecular Formula | C13H20BrN |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N-(bromomethyl)-2-(2,5-dimethylphenyl)-2-methylpropan-1-amine |
| SMILES | Cc1ccc(C)c(C(C)(C)CNCBr)c1 |
| InChI | InChI=1S/C13H20BrN/c1-10-5-6-11(2)12(7-10)13(3,4)8-15-9-14/h5-7,15H,8-9H2,1-4H3 |
| InChIKey | GGTUVIFHJLMWET-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|