C11H14BrF2N — CID 115262544
N-(bromomethyl)-2-(3,4-difluorophenyl)-2-methylpropan-1-amine (PubChem CID 115262544) has the molecular formula C11H14BrF2N and a molecular weight of 278.14 g/mol. Its IUPAC name is N-(bromomethyl)-2-(3,4-difluorophenyl)-2-methylpropan-1-amine.
| Compound Name | N-(bromomethyl)-2-(3,4-difluorophenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 115262544 |
| Molecular Formula | C11H14BrF2N |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N-(bromomethyl)-2-(3,4-difluorophenyl)-2-methylpropan-1-amine |
| SMILES | CC(C)(CNCBr)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14BrF2N/c1-11(2,6-15-7-12)8-3-4-9(13)10(14)5-8/h3-5,15H,6-7H2,1-2H3 |
| InChIKey | DGEOLELWQPFOEZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|