C10H12ClN3 — CID 115262747
N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine (PubChem CID 115262747) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine.
| Compound Name | N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 115262747 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine |
| SMILES | Cc1nc2cc(NCCl)ccc2n1C |
| InChI | InChI=1S/C10H12ClN3/c1-7-13-9-5-8(12-6-11)3-4-10(9)14(7)2/h3-5,12H,6H2,1-2H3 |
| InChIKey | LURHCVOZAFMGAS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|