About N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine
N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine (PubChem CID 115262747) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine.
Molecular Properties
| Compound Name | N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine |
| PubChem CID | 115262747 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine |
| SMILES | Cc1nc2cc(NCCl)ccc2n1C |
| InChI | InChI=1S/C10H12ClN3/c1-7-13-9-5-8(12-6-11)3-4-10(9)14(7)2/h3-5,12H,6H2,1-2H3 |
| InChIKey | LURHCVOZAFMGAS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine?
The IUPAC name of N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine (CID 115262747) is N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine.
What is the SMILES notation for N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine?
The canonical SMILES for N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine is Cc1nc2cc(NCCl)ccc2n1C.
What is the InChIKey of N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine?
The InChIKey is LURHCVOZAFMGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c1-7-13-9-5-8(12-6-11)3-4-10(9)14(7)2/h3-5,12H,6H2,1-2H3.
What are the key properties of N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine?
N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine has a molecular weight of 209.68 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(chloromethyl)-1,2-dimethylbenzimidazol-5-amine is sourced from PubChem (CID 115262747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).