C27H44O7S — CID 11526365
(2S,8S)-3-(benzenesulfonyl)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol (PubChem CID 11526365) has the molecular formula C27H44O7S and a molecular weight of 512.71 g/mol. Its IUPAC name is (2S,8S)-3-(benzenesulfonyl)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol.
| Compound Name | (2S,8S)-3-(benzenesulfonyl)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol |
|---|---|
| PubChem CID | 11526365 |
| Molecular Formula | C27H44O7S |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (2S,8S)-3-(benzenesulfonyl)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]nonan-5-ol |
| SMILES | C[C@@H]1COC(C)(C)O[C@@H]1[C@@H](C)CCC(O)CC([C@@H](C)[C@@H]1COC(C)(C)O1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H44O7S/c1-18(25-19(2)16-31-27(6,7)34-25)13-14-21(28)15-24(20(3)23-17-32-26(4,5)33-23)35(29,30)22-11-9-8-10-12-22/h8-12,18-21,23-25,28H,13-17H2,1-7H3/t18-,19+,20-,21?,23-,24?,25+/m0/s1 |
| InChIKey | TYLIPDVJCTZLGC-RVJPFOGBSA-N |
| XLogP | 4.57 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |