C12H17N5S — CID 115264438
2-[[6-[methyl(1H-pyrrol-3-ylmethyl)amino]pyrimidin-4-yl]amino]ethanethiol (PubChem CID 115264438) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is 2-[[6-[methyl(1H-pyrrol-3-ylmethyl)amino]pyrimidin-4-yl]amino]ethanethiol.
| Compound Name | 2-[[6-[methyl(1H-pyrrol-3-ylmethyl)amino]pyrimidin-4-yl]amino]ethanethiol |
|---|---|
| PubChem CID | 115264438 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[[6-[methyl(1H-pyrrol-3-ylmethyl)amino]pyrimidin-4-yl]amino]ethanethiol |
| SMILES | CN(Cc1cc[nH]c1)c1cc(NCCS)ncn1 |
| InChI | InChI=1S/C12H17N5S/c1-17(8-10-2-3-13-7-10)12-6-11(14-4-5-18)15-9-16-12/h2-3,6-7,9,13,18H,4-5,8H2,1H3,(H,14,15,16) |
| InChIKey | DMRIGYQRCQGYGT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|