C14H15N5O — CID 115265454
5-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]-1,3-dihydroindol-2-one (PubChem CID 115265454) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 5-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115265454 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-[methyl-[6-(methylamino)pyrimidin-4-yl]amino]-1,3-dihydroindol-2-one |
| SMILES | CNc1cc(N(C)c2ccc3c(c2)CC(=O)N3)ncn1 |
| InChI | InChI=1S/C14H15N5O/c1-15-12-7-13(17-8-16-12)19(2)10-3-4-11-9(5-10)6-14(20)18-11/h3-5,7-8H,6H2,1-2H3,(H,18,20)(H,15,16,17) |
| InChIKey | SSGQZBOSCDWMCF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|