About 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate
2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate (PubChem CID 11526614) has the molecular formula C26H28Cl2N4O4
and a molecular weight of 531.44 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate |
| PubChem CID | 11526614 |
| Molecular Formula | C26H28Cl2N4O4 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate |
| SMILES | COc1nc(NCCc2ccc(Cl)cc2Cl)cc(-c2cccc(C(=O)OCCN3CCOCC3)c2)n1 |
| InChI | InChI=1S/C26H28Cl2N4O4/c1-34-26-30-23(17-24(31-26)29-8-7-18-5-6-21(27)16-22(18)28)19-3-2-4-20(15-19)25(33)36-14-11-32-9-12-35-13-10-32/h2-6,15-17H,7-14H2,1H3,(H,29,30,31) |
| InChIKey | HJFDCMKUYBPOJP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate?
The IUPAC name of 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate (CID 11526614) is 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate.
What is the SMILES notation for 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate?
The canonical SMILES for 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate is COc1nc(NCCc2ccc(Cl)cc2Cl)cc(-c2cccc(C(=O)OCCN3CCOCC3)c2)n1.
What is the InChIKey of 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate?
The InChIKey is HJFDCMKUYBPOJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28Cl2N4O4/c1-34-26-30-23(17-24(31-26)29-8-7-18-5-6-21(27)16-22(18)28)19-3-2-4-20(15-19)25(33)36-14-11-32-9-12-35-13-10-32/h2-6,15-17H,7-14H2,1H3,(H,29,30,31).
What are the key properties of 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate?
2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate has a molecular weight of 531.44 g/mol, XLogP of 4.60, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 3-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]benzoate is sourced from PubChem (CID 11526614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).