C15H17N5 — CID 115266643
[2-methyl-6-(N,3,4-trimethylanilino)pyrimidin-4-yl]cyanamide (PubChem CID 115266643) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is [2-methyl-6-(N,3,4-trimethylanilino)pyrimidin-4-yl]cyanamide.
| Compound Name | [2-methyl-6-(N,3,4-trimethylanilino)pyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115266643 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | [2-methyl-6-(N,3,4-trimethylanilino)pyrimidin-4-yl]cyanamide |
| SMILES | Cc1nc(NC#N)cc(N(C)c2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C15H17N5/c1-10-5-6-13(7-11(10)2)20(4)15-8-14(17-9-16)18-12(3)19-15/h5-8H,1-4H3,(H,17,18,19) |
| InChIKey | YGRMKMXHDZBPSP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|