C14H21N5 — CID 115266821
2-[[6-(cyclohexylmethylamino)-2-methylpyrimidin-4-yl]amino]acetonitrile (PubChem CID 115266821) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-[[6-(cyclohexylmethylamino)-2-methylpyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[6-(cyclohexylmethylamino)-2-methylpyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 115266821 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-[[6-(cyclohexylmethylamino)-2-methylpyrimidin-4-yl]amino]acetonitrile |
| SMILES | Cc1nc(NCC#N)cc(NCC2CCCCC2)n1 |
| InChI | InChI=1S/C14H21N5/c1-11-18-13(16-8-7-15)9-14(19-11)17-10-12-5-3-2-4-6-12/h9,12H,2-6,8,10H2,1H3,(H2,16,17,18,19) |
| InChIKey | UEJPCLSWCIHTEY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|