C28H33F2N5O4 — CID 11526725
N-[(3R,6S)-6-(2,3-difluorophenyl)-1-(2-hydroxy-2-methylpropyl)-2-oxoazepan-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxamide (PubChem CID 11526725) has the molecular formula C28H33F2N5O4 and a molecular weight of 541.60 g/mol. Its IUPAC name is N-[(3R,6S)-6-(2,3-difluorophenyl)-1-(2-hydroxy-2-methylpropyl)-2-oxoazepan-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxamide.
| Compound Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-1-(2-hydroxy-2-methylpropyl)-2-oxoazepan-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 11526725 |
| Molecular Formula | C28H33F2N5O4 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-1-(2-hydroxy-2-methylpropyl)-2-oxoazepan-3-yl]-2-oxospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxamide |
| SMILES | CC(C)(O)CN1C[C@H](c2cccc(F)c2F)CC[C@@H](NC(=O)N2CCC3(CC2)C(=O)Nc2ncccc23)C1=O |
| InChI | InChI=1S/C28H33F2N5O4/c1-27(2,39)16-35-15-17(18-5-3-7-20(29)22(18)30)8-9-21(24(35)36)32-26(38)34-13-10-28(11-14-34)19-6-4-12-31-23(19)33-25(28)37/h3-7,12,17,21,39H,8-11,13-16H2,1-2H3,(H,32,38)(H,31,33,37)/t17-,21-/m1/s1 |
| InChIKey | MZVJMOGOXJUXBC-DYESRHJHSA-N |
| XLogP | 2.90 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |