C13H22N2O — CID 115267769
N-(5-amino-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)cyclobutanecarboxamide (PubChem CID 115267769) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-(5-amino-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)cyclobutanecarboxamide.
| Compound Name | N-(5-amino-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 115267769 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-(5-amino-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)cyclobutanecarboxamide |
| SMILES | NC1CC2CC(NC(=O)C3CCC3)CC2C1 |
| InChI | InChI=1S/C13H22N2O/c14-11-4-9-6-12(7-10(9)5-11)15-13(16)8-2-1-3-8/h8-12H,1-7,14H2,(H,15,16) |
| InChIKey | HBTLWPMVHMDJFS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |