C15H16BrN3O — CID 115268604
2-(2-bromophenyl)-N-[6-(ethylamino)-3-pyridinyl]acetamide (PubChem CID 115268604) has the molecular formula C15H16BrN3O and a molecular weight of 334.22 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-[6-(ethylamino)-3-pyridinyl]acetamide.
| Compound Name | 2-(2-bromophenyl)-N-[6-(ethylamino)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 115268604 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-(2-bromophenyl)-N-[6-(ethylamino)-3-pyridinyl]acetamide |
| SMILES | CCNc1ccc(NC(=O)Cc2ccccc2Br)cn1 |
| InChI | InChI=1S/C15H16BrN3O/c1-2-17-14-8-7-12(10-18-14)19-15(20)9-11-5-3-4-6-13(11)16/h3-8,10H,2,9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | WVBMJBRGMXFDGT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |