About N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide
N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide (PubChem CID 115268708) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide.
Molecular Properties
| Compound Name | N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide |
| PubChem CID | 115268708 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide |
| SMILES | CCNc1ccc(N(C)C(=O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C13H21N3O/c1-6-14-11-8-7-10(9-15-11)16(5)12(17)13(2,3)4/h7-9H,6H2,1-5H3,(H,14,15) |
| InChIKey | VMNTVECFMUGCCI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide?
The IUPAC name of N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide (CID 115268708) is N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide.
What is the SMILES notation for N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide?
The canonical SMILES for N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide is CCNc1ccc(N(C)C(=O)C(C)(C)C)cn1.
What is the InChIKey of N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide?
The InChIKey is VMNTVECFMUGCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-6-14-11-8-7-10(9-15-11)16(5)12(17)13(2,3)4/h7-9H,6H2,1-5H3,(H,14,15).
What are the key properties of N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide?
N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide has a molecular weight of 235.33 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(ethylamino)-3-pyridinyl]-N,2,2-trimethylpropanamide is sourced from PubChem (CID 115268708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).