C26H27Cl2F3N4O2 — CID 11526889
2-(2,4-dichlorophenyl)-5-methyl-N-piperidin-1-yl-1-[4-(4,4,4-trifluorobutoxy)phenyl]imidazole-4-carboxamide (PubChem CID 11526889) has the molecular formula C26H27Cl2F3N4O2 and a molecular weight of 555.43 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methyl-N-piperidin-1-yl-1-[4-(4,4,4-trifluorobutoxy)phenyl]imidazole-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methyl-N-piperidin-1-yl-1-[4-(4,4,4-trifluorobutoxy)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 11526889 |
| Molecular Formula | C26H27Cl2F3N4O2 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methyl-N-piperidin-1-yl-1-[4-(4,4,4-trifluorobutoxy)phenyl]imidazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(OCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H27Cl2F3N4O2/c1-17-23(25(36)33-34-13-3-2-4-14-34)32-24(21-11-6-18(27)16-22(21)28)35(17)19-7-9-20(10-8-19)37-15-5-12-26(29,30)31/h6-11,16H,2-5,12-15H2,1H3,(H,33,36) |
| InChIKey | WSQBYDZANOSFBX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|