C28H35BrN4O3 — CID 11526890
1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]urea (PubChem CID 11526890) has the molecular formula C28H35BrN4O3 and a molecular weight of 555.52 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]urea.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 11526890 |
| Molecular Formula | C28H35BrN4O3 |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-1-[4-[4-(2,3,4,5-tetrahydro-1-benzoxepin-9-yl)-1,4-diazepan-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCCN(c2cccc3c2OCCCC3)CC1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C28H35BrN4O3/c29-23-10-11-25-22(19-23)20-26(36-25)33(28(30)34)15-3-2-12-31-13-6-14-32(17-16-31)24-9-5-8-21-7-1-4-18-35-27(21)24/h5,8-11,19-20H,1-4,6-7,12-18H2,(H2,30,34) |
| InChIKey | DSNKSGLONQSQCD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|