C20H15Br2O3PS2 — CID 11526915
3,7-dibromo-11-(2,5-dimethylphenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine (PubChem CID 11526915) has the molecular formula C20H15Br2O3PS2 and a molecular weight of 558.25 g/mol. Its IUPAC name is 3,7-dibromo-11-(2,5-dimethylphenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine.
| Compound Name | 3,7-dibromo-11-(2,5-dimethylphenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine |
|---|---|
| PubChem CID | 11526915 |
| Molecular Formula | C20H15Br2O3PS2 |
| Molecular Weight | 558.25 g/mol |
| Exact Mass | 555.86 |
| IUPAC Name | 3,7-dibromo-11-(2,5-dimethylphenoxy)-11-sulfanylidenebenzo[d][1,3,6,2]benzodioxathiaphosphocine |
| SMILES | Cc1ccc(C)c(OP2(=S)Oc3ccc(Br)cc3Sc3cc(Br)ccc3O2)c1 |
| InChI | InChI=1S/C20H15Br2O3PS2/c1-12-3-4-13(2)18(9-12)25-26(27)23-16-7-5-14(21)10-19(16)28-20-11-15(22)6-8-17(20)24-26/h3-11H,1-2H3 |
| InChIKey | CZJJHABESXJZPJ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.25 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|