About 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide
3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 115269861) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide |
| PubChem CID | 115269861 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CCC(C)(C)C(O)C1 |
| InChI | InChI=1S/C11H22N2O2/c1-8(2)12-10(15)13-6-5-11(3,4)9(14)7-13/h8-9,14H,5-7H2,1-4H3,(H,12,15) |
| InChIKey | VVWNBDISJJABQQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide?
The IUPAC name of 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide (CID 115269861) is 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide.
What is the SMILES notation for 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide?
The canonical SMILES for 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide is CC(C)NC(=O)N1CCC(C)(C)C(O)C1.
What is the InChIKey of 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide?
The InChIKey is VVWNBDISJJABQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-8(2)12-10(15)13-6-5-11(3,4)9(14)7-13/h8-9,14H,5-7H2,1-4H3,(H,12,15).
What are the key properties of 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide?
3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide has a molecular weight of 214.31 g/mol, XLogP of 1.20, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4,4-dimethyl-N-propan-2-ylpiperidine-1-carboxamide is sourced from PubChem (CID 115269861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).