C27H28F5N5O3 — CID 11526993
N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2-oxospiro[1,3-dihydro-1,8-naphthyridine-4,4'-piperidine]-1'-carboxamide (PubChem CID 11526993) has the molecular formula C27H28F5N5O3 and a molecular weight of 565.54 g/mol. Its IUPAC name is N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2-oxospiro[1,3-dihydro-1,8-naphthyridine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2-oxospiro[1,3-dihydro-1,8-naphthyridine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 11526993 |
| Molecular Formula | C27H28F5N5O3 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | N-[(3R,6S)-6-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)azepan-3-yl]-2-oxospiro[1,3-dihydro-1,8-naphthyridine-4,4'-piperidine]-1'-carboxamide |
| SMILES | O=C1CC2(CCN(C(=O)N[C@@H]3CC[C@@H](c4cccc(F)c4F)CN(CC(F)(F)F)C3=O)CC2)c2cccnc2N1 |
| InChI | InChI=1S/C27H28F5N5O3/c28-19-5-1-3-17(22(19)29)16-6-7-20(24(39)37(14-16)15-27(30,31)32)34-25(40)36-11-8-26(9-12-36)13-21(38)35-23-18(26)4-2-10-33-23/h1-5,10,16,20H,6-9,11-15H2,(H,34,40)(H,33,35,38)/t16-,20-/m1/s1 |
| InChIKey | QQUAFLOYNUYKDZ-OXQOHEQNSA-N |
| XLogP | 4.08 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |