C14H20N2O3 — CID 115270475
2-methyl-1-[4-(1H-pyrrol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 115270475) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-methyl-1-[4-(1H-pyrrol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 2-methyl-1-[4-(1H-pyrrol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 115270475 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-methyl-1-[4-(1H-pyrrol-2-yl)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN1C(=O)CCCc1ccc[nH]1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(13(18)19)8-4-10-16(14)12(17)7-2-5-11-6-3-9-15-11/h3,6,9,15H,2,4-5,7-8,10H2,1H3,(H,18,19) |
| InChIKey | FWYOJHFLULLBKV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |