C34H38N2O2S — CID 11527084
N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide (PubChem CID 11527084) has the molecular formula C34H38N2O2S and a molecular weight of 538.76 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11527084 |
| Molecular Formula | C34H38N2O2S |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide |
| SMILES | C[C@]12CC[C@@H](NC(=O)c3cc4ccccc4s3)C[C@@]1(c1cccc(O)c1)CCN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C34H38N2O2S/c1-33-17-16-28(35-32(38)31-21-26-12-5-6-15-30(26)39-31)23-34(33,27-13-7-14-29(37)22-27)18-20-36(24-33)19-8-11-25-9-3-2-4-10-25/h2-7,9-10,12-15,21-22,28,37H,8,11,16-20,23-24H2,1H3,(H,35,38)/t28-,33-,34-/m1/s1 |
| InChIKey | MWJUMFLAZVGIOY-RCFSOVDESA-N |
| XLogP | 7.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |