C28H30N2O4S4 — CID 11527163
trans-(1R,2R)-1-N,2-N-bis[(5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)methyl]cyclohexane-1,2-diamine (PubChem CID 11527163) has the molecular formula C28H30N2O4S4 and a molecular weight of 586.83 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis[(5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis[(5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 11527163 |
| Molecular Formula | C28H30N2O4S4 |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis[(5-thiophen-2-yl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)methyl]cyclohexane-1,2-diamine |
| SMILES | c1csc(-c2sc(CN[C@@H]3CCCC[C@H]3NCc3sc(-c4cccs4)c4c3OCCO4)c3c2OCCO3)c1 |
| InChI | InChI=1S/C28H30N2O4S4/c1-2-6-18(30-16-22-24-26(34-12-10-32-24)28(38-22)20-8-4-14-36-20)17(5-1)29-15-21-23-25(33-11-9-31-23)27(37-21)19-7-3-13-35-19/h3-4,7-8,13-14,17-18,29-30H,1-2,5-6,9-12,15-16H2/t17-,18-/m1/s1 |
| InChIKey | GECCHOMVRNWWOL-QZTJIDSGSA-N |
| XLogP | 7.00 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |