C14H17N3O2 — CID 115272850
N-(3-aminocyclopentyl)-2-methyl-1,3-benzoxazole-6-carboxamide (PubChem CID 115272850) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(3-aminocyclopentyl)-2-methyl-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(3-aminocyclopentyl)-2-methyl-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 115272850 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-(3-aminocyclopentyl)-2-methyl-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NC3CCC(N)C3)cc2o1 |
| InChI | InChI=1S/C14H17N3O2/c1-8-16-12-5-2-9(6-13(12)19-8)14(18)17-11-4-3-10(15)7-11/h2,5-6,10-11H,3-4,7,15H2,1H3,(H,17,18) |
| InChIKey | JXJGAPGAYYMXIK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |