C12H18N2OS — CID 115273030
1-(2-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone (PubChem CID 115273030) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-(2-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone.
| Compound Name | 1-(2-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 115273030 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(2-methylpiperazin-1-yl)-2-(3-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccsc1CC(=O)N1CCNCC1C |
| InChI | InChI=1S/C12H18N2OS/c1-9-3-6-16-11(9)7-12(15)14-5-4-13-8-10(14)2/h3,6,10,13H,4-5,7-8H2,1-2H3 |
| InChIKey | OJDPHONWHXWXHZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |