About 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde
7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde (PubChem CID 115273276) has the molecular formula C11H15N3O3S
and a molecular weight of 269.33 g/mol. Its IUPAC name is 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde |
| PubChem CID | 115273276 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde |
| SMILES | O=Cc1ncn2c1CN(S(=O)(=O)C1CCC1)CC2 |
| InChI | InChI=1S/C11H15N3O3S/c15-7-10-11-6-14(5-4-13(11)8-12-10)18(16,17)9-2-1-3-9/h7-9H,1-6H2 |
| InChIKey | BPIHSVRFJCQQCH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde?
The IUPAC name of 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde (CID 115273276) is 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde.
What is the SMILES notation for 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde?
The canonical SMILES for 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde is O=Cc1ncn2c1CN(S(=O)(=O)C1CCC1)CC2.
What is the InChIKey of 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde?
The InChIKey is BPIHSVRFJCQQCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S/c15-7-10-11-6-14(5-4-13(11)8-12-10)18(16,17)9-2-1-3-9/h7-9H,1-6H2.
What are the key properties of 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde?
7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde has a molecular weight of 269.33 g/mol, XLogP of 0.39, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclobutylsulfonyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carbaldehyde is sourced from PubChem (CID 115273276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).