About 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid
6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid (PubChem CID 115273621) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid |
| PubChem CID | 115273621 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid |
| SMILES | CN(C(=O)CCC(C)(C)C)c1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C14H20N2O3/c1-14(2,3)8-7-12(17)16(4)11-6-5-10(9-15-11)13(18)19/h5-6,9H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | CWUJVMXLLWDYBG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid?
The IUPAC name of 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid (CID 115273621) is 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid?
The canonical SMILES for 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid is CN(C(=O)CCC(C)(C)C)c1ccc(C(=O)O)cn1.
What is the InChIKey of 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid?
The InChIKey is CWUJVMXLLWDYBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-14(2,3)8-7-12(17)16(4)11-6-5-10(9-15-11)13(18)19/h5-6,9H,7-8H2,1-4H3,(H,18,19).
What are the key properties of 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid?
6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid has a molecular weight of 264.32 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4,4-dimethylpentanoyl(methyl)amino]pyridine-3-carboxylic acid is sourced from PubChem (CID 115273621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).