About (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone
(3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone (PubChem CID 115275915) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone.
Molecular Properties
| Compound Name | (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone |
| PubChem CID | 115275915 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone |
| SMILES | CC1(C)C(N)CCCN1C(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C12H19N3O/c1-12(2)10(13)6-4-8-15(12)11(16)9-5-3-7-14-9/h3,5,7,10,14H,4,6,8,13H2,1-2H3 |
| InChIKey | QRWLLRAPOCXEQE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone?
The IUPAC name of (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone (CID 115275915) is (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone.
What is the SMILES notation for (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone?
The canonical SMILES for (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone is CC1(C)C(N)CCCN1C(=O)c1ccc[nH]1.
What is the InChIKey of (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone?
The InChIKey is QRWLLRAPOCXEQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-12(2)10(13)6-4-8-15(12)11(16)9-5-3-7-14-9/h3,5,7,10,14H,4,6,8,13H2,1-2H3.
What are the key properties of (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone?
(3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone has a molecular weight of 221.30 g/mol, XLogP of 1.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2,2-dimethylpiperidin-1-yl)-(1H-pyrrol-2-yl)methanone is sourced from PubChem (CID 115275915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).