C15H20N2O2 — CID 115276097
2,2-dimethyl-1-(3-pyridin-3-ylpropanoyl)piperidin-4-one (PubChem CID 115276097) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3-pyridin-3-ylpropanoyl)piperidin-4-one.
| Compound Name | 2,2-dimethyl-1-(3-pyridin-3-ylpropanoyl)piperidin-4-one |
|---|---|
| PubChem CID | 115276097 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2,2-dimethyl-1-(3-pyridin-3-ylpropanoyl)piperidin-4-one |
| SMILES | CC1(C)CC(=O)CCN1C(=O)CCc1cccnc1 |
| InChI | InChI=1S/C15H20N2O2/c1-15(2)10-13(18)7-9-17(15)14(19)6-5-12-4-3-8-16-11-12/h3-4,8,11H,5-7,9-10H2,1-2H3 |
| InChIKey | VYIZGPNOXWIJHJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |