About 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol
1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol (PubChem CID 115276188) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol.
Molecular Properties
| Compound Name | 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol |
| PubChem CID | 115276188 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol |
| SMILES | CC1(C)CCC(O)CN1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-10(2,3)16(14,15)12-8-9(13)6-7-11(12,4)5/h9,13H,6-8H2,1-5H3 |
| InChIKey | ACACGVWNITZLSN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol?
The IUPAC name of 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol (CID 115276188) is 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol.
What is the SMILES notation for 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol?
The canonical SMILES for 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol is CC1(C)CCC(O)CN1S(=O)(=O)C(C)(C)C.
What is the InChIKey of 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol?
The InChIKey is ACACGVWNITZLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3S/c1-10(2,3)16(14,15)12-8-9(13)6-7-11(12,4)5/h9,13H,6-8H2,1-5H3.
What are the key properties of 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol?
1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol has a molecular weight of 249.38 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfonyl-6,6-dimethylpiperidin-3-ol is sourced from PubChem (CID 115276188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).