C34H37N3O8S2 — CID 11527635
N-(2-phenylethyl)-2-[2,3,4-trihydroxy-5-[methyl(3-phenylpropyl)sulfamoyl]benzoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 11527635) has the molecular formula C34H37N3O8S2 and a molecular weight of 679.82 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[2,3,4-trihydroxy-5-[methyl(3-phenylpropyl)sulfamoyl]benzoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | N-(2-phenylethyl)-2-[2,3,4-trihydroxy-5-[methyl(3-phenylpropyl)sulfamoyl]benzoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 11527635 |
| Molecular Formula | C34H37N3O8S2 |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | N-(2-phenylethyl)-2-[2,3,4-trihydroxy-5-[methyl(3-phenylpropyl)sulfamoyl]benzoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CN(CCCc1ccccc1)S(=O)(=O)c1cc(C(=O)N2CCc3ccc(S(=O)(=O)NCCc4ccccc4)cc3C2)c(O)c(O)c1O |
| InChI | InChI=1S/C34H37N3O8S2/c1-36(19-8-13-24-9-4-2-5-10-24)47(44,45)30-22-29(31(38)33(40)32(30)39)34(41)37-20-17-26-14-15-28(21-27(26)23-37)46(42,43)35-18-16-25-11-6-3-7-12-25/h2-7,9-12,14-15,21-22,35,38-40H,8,13,16-20,23H2,1H3 |
| InChIKey | MSGQUTXPOGRULO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|